About 3-[(1R,2R)-2-hydroxycyclohexyl]-1-(3-hydroxypropyl)-1-(naphthalen-1-ylmethyl)urea
3-[(1R,2R)-2-hydroxycyclohexyl]-1-(3-hydroxypropyl)-1-(naphthalen-1-ylmethyl)urea (PubChem CID 122567269) has the molecular formula C21H28N2O3
and a molecular weight of 356.47 g/mol. Its IUPAC name is 3-[(1R,2R)-2-hydroxycyclohexyl]-1-(3-hydroxypropyl)-1-(naphthalen-1-ylmethyl)urea.
Molecular Properties
| Compound Name | 3-[(1R,2R)-2-hydroxycyclohexyl]-1-(3-hydroxypropyl)-1-(naphthalen-1-ylmethyl)urea |
| PubChem CID | 122567269 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 3-[(1R,2R)-2-hydroxycyclohexyl]-1-(3-hydroxypropyl)-1-(naphthalen-1-ylmethyl)urea |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1O)N(CCCO)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C21H28N2O3/c24-14-6-13-23(21(26)22-19-11-3-4-12-20(19)25)15-17-9-5-8-16-7-1-2-10-18(16)17/h1-2,5,7-10,19-20,24-25H,3-4,6,11-15H2,(H,22,26)/t19-,20-/m1/s1 |
| InChIKey | PZWXPNMPPLQRRS-WOJBJXKFSA-N |
| XLogP | 3.04 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(1R,2R)-2-hydroxycyclohexyl]-1-(3-hydroxypropyl)-1-(naphthalen-1-ylmethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1R,2R)-2-hydroxycyclohexyl]-1-(3-hydroxypropyl)-1-(naphthalen-1-ylmethyl)urea?
The IUPAC name of 3-[(1R,2R)-2-hydroxycyclohexyl]-1-(3-hydroxypropyl)-1-(naphthalen-1-ylmethyl)urea (CID 122567269) is 3-[(1R,2R)-2-hydroxycyclohexyl]-1-(3-hydroxypropyl)-1-(naphthalen-1-ylmethyl)urea.
What is the SMILES notation for 3-[(1R,2R)-2-hydroxycyclohexyl]-1-(3-hydroxypropyl)-1-(naphthalen-1-ylmethyl)urea?
The canonical SMILES for 3-[(1R,2R)-2-hydroxycyclohexyl]-1-(3-hydroxypropyl)-1-(naphthalen-1-ylmethyl)urea is O=C(N[C@@H]1CCCC[C@H]1O)N(CCCO)Cc1cccc2ccccc12.
What is the InChIKey of 3-[(1R,2R)-2-hydroxycyclohexyl]-1-(3-hydroxypropyl)-1-(naphthalen-1-ylmethyl)urea?
The InChIKey is PZWXPNMPPLQRRS-WOJBJXKFSA-N. The full InChI is InChI=1S/C21H28N2O3/c24-14-6-13-23(21(26)22-19-11-3-4-12-20(19)25)15-17-9-5-8-16-7-1-2-10-18(16)17/h1-2,5,7-10,19-20,24-25H,3-4,6,11-15H2,(H,22,26)/t19-,20-/m1/s1.
What are the key properties of 3-[(1R,2R)-2-hydroxycyclohexyl]-1-(3-hydroxypropyl)-1-(naphthalen-1-ylmethyl)urea?
3-[(1R,2R)-2-hydroxycyclohexyl]-1-(3-hydroxypropyl)-1-(naphthalen-1-ylmethyl)urea has a molecular weight of 356.47 g/mol, XLogP of 3.04, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1R,2R)-2-hydroxycyclohexyl]-1-(3-hydroxypropyl)-1-(naphthalen-1-ylmethyl)urea is sourced from PubChem (CID 122567269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).