About 4-(hydroxymethyl)-N-[(3S,4R)-4-methoxyoxolan-3-yl]benzamide
4-(hydroxymethyl)-N-[(3S,4R)-4-methoxyoxolan-3-yl]benzamide (PubChem CID 122568690) has the molecular formula C13H17NO4
and a molecular weight of 251.28 g/mol. Its IUPAC name is 4-(hydroxymethyl)-N-[(3S,4R)-4-methoxyoxolan-3-yl]benzamide.
Molecular Properties
| Compound Name | 4-(hydroxymethyl)-N-[(3S,4R)-4-methoxyoxolan-3-yl]benzamide |
| PubChem CID | 122568690 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 4-(hydroxymethyl)-N-[(3S,4R)-4-methoxyoxolan-3-yl]benzamide |
| SMILES | CO[C@H]1COC[C@@H]1NC(=O)c1ccc(CO)cc1 |
| InChI | InChI=1S/C13H17NO4/c1-17-12-8-18-7-11(12)14-13(16)10-4-2-9(6-15)3-5-10/h2-5,11-12,15H,6-8H2,1H3,(H,14,16)/t11-,12-/m0/s1 |
| InChIKey | BEVIXQCWPIWSJL-RYUDHWBXSA-N |
| XLogP | 0.32 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(hydroxymethyl)-N-[(3S,4R)-4-methoxyoxolan-3-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxymethyl)-N-[(3S,4R)-4-methoxyoxolan-3-yl]benzamide?
The IUPAC name of 4-(hydroxymethyl)-N-[(3S,4R)-4-methoxyoxolan-3-yl]benzamide (CID 122568690) is 4-(hydroxymethyl)-N-[(3S,4R)-4-methoxyoxolan-3-yl]benzamide.
What is the SMILES notation for 4-(hydroxymethyl)-N-[(3S,4R)-4-methoxyoxolan-3-yl]benzamide?
The canonical SMILES for 4-(hydroxymethyl)-N-[(3S,4R)-4-methoxyoxolan-3-yl]benzamide is CO[C@H]1COC[C@@H]1NC(=O)c1ccc(CO)cc1.
What is the InChIKey of 4-(hydroxymethyl)-N-[(3S,4R)-4-methoxyoxolan-3-yl]benzamide?
The InChIKey is BEVIXQCWPIWSJL-RYUDHWBXSA-N. The full InChI is InChI=1S/C13H17NO4/c1-17-12-8-18-7-11(12)14-13(16)10-4-2-9(6-15)3-5-10/h2-5,11-12,15H,6-8H2,1H3,(H,14,16)/t11-,12-/m0/s1.
What are the key properties of 4-(hydroxymethyl)-N-[(3S,4R)-4-methoxyoxolan-3-yl]benzamide?
4-(hydroxymethyl)-N-[(3S,4R)-4-methoxyoxolan-3-yl]benzamide has a molecular weight of 251.28 g/mol, XLogP of 0.32, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethyl)-N-[(3S,4R)-4-methoxyoxolan-3-yl]benzamide is sourced from PubChem (CID 122568690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).