C21H26N2O2S — CID 122570045
1,4-diazepan-1-yl-[4-[4-(2-hydroxyethylsulfanylmethyl)phenyl]phenyl]methanone (PubChem CID 122570045) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is 1,4-diazepan-1-yl-[4-[4-(2-hydroxyethylsulfanylmethyl)phenyl]phenyl]methanone.
| Compound Name | 1,4-diazepan-1-yl-[4-[4-(2-hydroxyethylsulfanylmethyl)phenyl]phenyl]methanone |
|---|---|
| PubChem CID | 122570045 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 1,4-diazepan-1-yl-[4-[4-(2-hydroxyethylsulfanylmethyl)phenyl]phenyl]methanone |
| SMILES | O=C(c1ccc(-c2ccc(CSCCO)cc2)cc1)N1CCCNCC1 |
| InChI | InChI=1S/C21H26N2O2S/c24-14-15-26-16-17-2-4-18(5-3-17)19-6-8-20(9-7-19)21(25)23-12-1-10-22-11-13-23/h2-9,22,24H,1,10-16H2 |
| InChIKey | BVWBCRKAOLUQIP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|