C18H28N2O4 — CID 122570060
N-[(2-ethoxy-3-methoxyphenyl)methyl]-2-(ethoxymethyl)pyrrolidine-1-carboxamide (PubChem CID 122570060) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is N-[(2-ethoxy-3-methoxyphenyl)methyl]-2-(ethoxymethyl)pyrrolidine-1-carboxamide.
| Compound Name | N-[(2-ethoxy-3-methoxyphenyl)methyl]-2-(ethoxymethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 122570060 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-[(2-ethoxy-3-methoxyphenyl)methyl]-2-(ethoxymethyl)pyrrolidine-1-carboxamide |
| SMILES | CCOCC1CCCN1C(=O)NCc1cccc(OC)c1OCC |
| InChI | InChI=1S/C18H28N2O4/c1-4-23-13-15-9-7-11-20(15)18(21)19-12-14-8-6-10-16(22-3)17(14)24-5-2/h6,8,10,15H,4-5,7,9,11-13H2,1-3H3,(H,19,21) |
| InChIKey | FAWAGOKNUYMNIU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |