C14H22FN5O2 — CID 122570506
1-[3-[(5-fluoro-4-methoxypyrimidin-2-yl)amino]propyl]piperidine-4-carboxamide (PubChem CID 122570506) has the molecular formula C14H22FN5O2 and a molecular weight of 311.36 g/mol. Its IUPAC name is 1-[3-[(5-fluoro-4-methoxypyrimidin-2-yl)amino]propyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-[(5-fluoro-4-methoxypyrimidin-2-yl)amino]propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 122570506 |
| Molecular Formula | C14H22FN5O2 |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | 1-[3-[(5-fluoro-4-methoxypyrimidin-2-yl)amino]propyl]piperidine-4-carboxamide |
| SMILES | COc1nc(NCCCN2CCC(C(N)=O)CC2)ncc1F |
| InChI | InChI=1S/C14H22FN5O2/c1-22-13-11(15)9-18-14(19-13)17-5-2-6-20-7-3-10(4-8-20)12(16)21/h9-10H,2-8H2,1H3,(H2,16,21)(H,17,18,19) |
| InChIKey | UVBQKJBZGVBSDD-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|