C15H25N7OS — CID 122571066
1-methyl-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-1-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]urea (PubChem CID 122571066) has the molecular formula C15H25N7OS and a molecular weight of 351.48 g/mol. Its IUPAC name is 1-methyl-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-1-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]urea.
| Compound Name | 1-methyl-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-1-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]urea |
|---|---|
| PubChem CID | 122571066 |
| Molecular Formula | C15H25N7OS |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 1-methyl-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-1-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]urea |
| SMILES | Cc1[nH]cnc1CSCCNC(=O)N(C)Cc1nncn1C(C)C |
| InChI | InChI=1S/C15H25N7OS/c1-11(2)22-10-19-20-14(22)7-21(4)15(23)16-5-6-24-8-13-12(3)17-9-18-13/h9-11H,5-8H2,1-4H3,(H,16,23)(H,17,18) |
| InChIKey | MYOUTOATPVANFD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|