About 3-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-4-methylbenzenesulfonamide
3-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-4-methylbenzenesulfonamide (PubChem CID 122572087) has the molecular formula C13H19FN2O3S
and a molecular weight of 302.37 g/mol. Its IUPAC name is 3-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-4-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | 3-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-4-methylbenzenesulfonamide |
| PubChem CID | 122572087 |
| Molecular Formula | C13H19FN2O3S |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 3-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-4-methylbenzenesulfonamide |
| SMILES | CO[C@H]1CN(C)C[C@@H]1NS(=O)(=O)c1ccc(C)c(F)c1 |
| InChI | InChI=1S/C13H19FN2O3S/c1-9-4-5-10(6-11(9)14)20(17,18)15-12-7-16(2)8-13(12)19-3/h4-6,12-13,15H,7-8H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | ANXWVCXSSDZQRX-STQMWFEESA-N |
| XLogP | 0.74 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-4-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-4-methylbenzenesulfonamide?
The IUPAC name of 3-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-4-methylbenzenesulfonamide (CID 122572087) is 3-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-4-methylbenzenesulfonamide.
What is the SMILES notation for 3-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-4-methylbenzenesulfonamide?
The canonical SMILES for 3-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-4-methylbenzenesulfonamide is CO[C@H]1CN(C)C[C@@H]1NS(=O)(=O)c1ccc(C)c(F)c1.
What is the InChIKey of 3-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-4-methylbenzenesulfonamide?
The InChIKey is ANXWVCXSSDZQRX-STQMWFEESA-N. The full InChI is InChI=1S/C13H19FN2O3S/c1-9-4-5-10(6-11(9)14)20(17,18)15-12-7-16(2)8-13(12)19-3/h4-6,12-13,15H,7-8H2,1-3H3/t12-,13-/m0/s1.
What are the key properties of 3-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-4-methylbenzenesulfonamide?
3-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-4-methylbenzenesulfonamide has a molecular weight of 302.37 g/mol, XLogP of 0.74, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-N-[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]-4-methylbenzenesulfonamide is sourced from PubChem (CID 122572087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).