C11H15F3N2O2 — CID 122572171
(1R,6R)-6-(4,4,4-trifluorobutanoylamino)cyclohex-3-ene-1-carboxamide (PubChem CID 122572171) has the molecular formula C11H15F3N2O2 and a molecular weight of 264.25 g/mol. Its IUPAC name is (1R,6R)-6-(4,4,4-trifluorobutanoylamino)cyclohex-3-ene-1-carboxamide.
| Compound Name | (1R,6R)-6-(4,4,4-trifluorobutanoylamino)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 122572171 |
| Molecular Formula | C11H15F3N2O2 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | (1R,6R)-6-(4,4,4-trifluorobutanoylamino)cyclohex-3-ene-1-carboxamide |
| SMILES | NC(=O)[C@@H]1CC=CC[C@H]1NC(=O)CCC(F)(F)F |
| InChI | InChI=1S/C11H15F3N2O2/c12-11(13,14)6-5-9(17)16-8-4-2-1-3-7(8)10(15)18/h1-2,7-8H,3-6H2,(H2,15,18)(H,16,17)/t7-,8-/m1/s1 |
| InChIKey | PVWXTVCCVZUPLV-HTQZYQBOSA-N |
| XLogP | 1.27 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|