C20H24N6O — CID 122572204
N-methyl-3-[3-(methylamino)pyrazin-2-yl]-N-[(3-propyl-1H-pyrazol-5-yl)methyl]benzamide (PubChem CID 122572204) has the molecular formula C20H24N6O and a molecular weight of 364.45 g/mol. Its IUPAC name is N-methyl-3-[3-(methylamino)pyrazin-2-yl]-N-[(3-propyl-1H-pyrazol-5-yl)methyl]benzamide.
| Compound Name | N-methyl-3-[3-(methylamino)pyrazin-2-yl]-N-[(3-propyl-1H-pyrazol-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 122572204 |
| Molecular Formula | C20H24N6O |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | N-methyl-3-[3-(methylamino)pyrazin-2-yl]-N-[(3-propyl-1H-pyrazol-5-yl)methyl]benzamide |
| SMILES | CCCc1cc(CN(C)C(=O)c2cccc(-c3nccnc3NC)c2)[nH]n1 |
| InChI | InChI=1S/C20H24N6O/c1-4-6-16-12-17(25-24-16)13-26(3)20(27)15-8-5-7-14(11-15)18-19(21-2)23-10-9-22-18/h5,7-12H,4,6,13H2,1-3H3,(H,21,23)(H,24,25) |
| InChIKey | BBYFXQUOIKLMET-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |