C17H15N3O3 — CID 122572557
2-[[2-(4-methoxynaphthalen-1-yl)pyrimidin-4-yl]amino]acetic acid (PubChem CID 122572557) has the molecular formula C17H15N3O3 and a molecular weight of 309.33 g/mol. Its IUPAC name is 2-[[2-(4-methoxynaphthalen-1-yl)pyrimidin-4-yl]amino]acetic acid.
| Compound Name | 2-[[2-(4-methoxynaphthalen-1-yl)pyrimidin-4-yl]amino]acetic acid |
|---|---|
| PubChem CID | 122572557 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-[[2-(4-methoxynaphthalen-1-yl)pyrimidin-4-yl]amino]acetic acid |
| SMILES | COc1ccc(-c2nccc(NCC(=O)O)n2)c2ccccc12 |
| InChI | InChI=1S/C17H15N3O3/c1-23-14-7-6-13(11-4-2-3-5-12(11)14)17-18-9-8-15(20-17)19-10-16(21)22/h2-9H,10H2,1H3,(H,21,22)(H,18,19,20) |
| InChIKey | PPOOAQJVIQUYBE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |