C33H47N3O2 — CID 122573036
1-(6-acetyl-2-pyridinyl)ethanone;bis(2,6-di(propan-2-yl)aniline) (PubChem CID 122573036) has the molecular formula C33H47N3O2 and a molecular weight of 517.76 g/mol. Its IUPAC name is 1-(6-acetyl-2-pyridinyl)ethanone;bis(2,6-di(propan-2-yl)aniline).
| Compound Name | 1-(6-acetyl-2-pyridinyl)ethanone;bis(2,6-di(propan-2-yl)aniline) |
|---|---|
| PubChem CID | 122573036 |
| Molecular Formula | C33H47N3O2 |
| Molecular Weight | 517.76 g/mol |
| Exact Mass | 517.37 |
| IUPAC Name | 1-(6-acetyl-2-pyridinyl)ethanone;bis(2,6-di(propan-2-yl)aniline) |
| SMILES | CC(=O)c1cccc(C(C)=O)n1.CC(C)c1cccc(C(C)C)c1N.CC(C)c1cccc(C(C)C)c1N |
| InChI | InChI=1S/2C12H19N.C9H9NO2/c2*1-8(2)10-6-5-7-11(9(3)4)12(10)13;1-6(11)8-4-3-5-9(10-8)7(2)12/h2*5-9H,13H2,1-4H3;3-5H,1-2H3 |
| InChIKey | PAWHIKCCVBDPKC-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.76 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|