About [5-(difluoromethyl)-6-(1,3-dioxolan-2-yl)-2-pyridinyl]-methylcarbamic acid
[5-(difluoromethyl)-6-(1,3-dioxolan-2-yl)-2-pyridinyl]-methylcarbamic acid (PubChem CID 122573630) has the molecular formula C11H12F2N2O4
and a molecular weight of 274.22 g/mol. Its IUPAC name is [5-(difluoromethyl)-6-(1,3-dioxolan-2-yl)-2-pyridinyl]-methylcarbamic acid.
Molecular Properties
| Compound Name | [5-(difluoromethyl)-6-(1,3-dioxolan-2-yl)-2-pyridinyl]-methylcarbamic acid |
| PubChem CID | 122573630 |
| Molecular Formula | C11H12F2N2O4 |
| Molecular Weight | 274.22 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | [5-(difluoromethyl)-6-(1,3-dioxolan-2-yl)-2-pyridinyl]-methylcarbamic acid |
| SMILES | CN(C(=O)O)c1ccc(C(F)F)c(C2OCCO2)n1 |
| InChI | InChI=1S/C11H12F2N2O4/c1-15(11(16)17)7-3-2-6(9(12)13)8(14-7)10-18-4-5-19-10/h2-3,9-10H,4-5H2,1H3,(H,16,17) |
| InChIKey | CGIZSHOPZXJANM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(difluoromethyl)-6-(1,3-dioxolan-2-yl)-2-pyridinyl]-methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(difluoromethyl)-6-(1,3-dioxolan-2-yl)-2-pyridinyl]-methylcarbamic acid?
The IUPAC name of [5-(difluoromethyl)-6-(1,3-dioxolan-2-yl)-2-pyridinyl]-methylcarbamic acid (CID 122573630) is [5-(difluoromethyl)-6-(1,3-dioxolan-2-yl)-2-pyridinyl]-methylcarbamic acid.
What is the SMILES notation for [5-(difluoromethyl)-6-(1,3-dioxolan-2-yl)-2-pyridinyl]-methylcarbamic acid?
The canonical SMILES for [5-(difluoromethyl)-6-(1,3-dioxolan-2-yl)-2-pyridinyl]-methylcarbamic acid is CN(C(=O)O)c1ccc(C(F)F)c(C2OCCO2)n1.
What is the InChIKey of [5-(difluoromethyl)-6-(1,3-dioxolan-2-yl)-2-pyridinyl]-methylcarbamic acid?
The InChIKey is CGIZSHOPZXJANM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F2N2O4/c1-15(11(16)17)7-3-2-6(9(12)13)8(14-7)10-18-4-5-19-10/h2-3,9-10H,4-5H2,1H3,(H,16,17).
What are the key properties of [5-(difluoromethyl)-6-(1,3-dioxolan-2-yl)-2-pyridinyl]-methylcarbamic acid?
[5-(difluoromethyl)-6-(1,3-dioxolan-2-yl)-2-pyridinyl]-methylcarbamic acid has a molecular weight of 274.22 g/mol, XLogP of 2.18, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(difluoromethyl)-6-(1,3-dioxolan-2-yl)-2-pyridinyl]-methylcarbamic acid is sourced from PubChem (CID 122573630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).