C28H30ClFN4O3 — CID 122573902
2-[1-[7-tert-butyl-5-(4-chloro-3-fluorophenyl)furo[3,2-b]pyridine-2-carbonyl]-2,2-dimethylpiperidin-4-yl]-N-cyanoacetamide (PubChem CID 122573902) has the molecular formula C28H30ClFN4O3 and a molecular weight of 525.02 g/mol. Its IUPAC name is 2-[1-[7-tert-butyl-5-(4-chloro-3-fluorophenyl)furo[3,2-b]pyridine-2-carbonyl]-2,2-dimethylpiperidin-4-yl]-N-cyanoacetamide.
| Compound Name | 2-[1-[7-tert-butyl-5-(4-chloro-3-fluorophenyl)furo[3,2-b]pyridine-2-carbonyl]-2,2-dimethylpiperidin-4-yl]-N-cyanoacetamide |
|---|---|
| PubChem CID | 122573902 |
| Molecular Formula | C28H30ClFN4O3 |
| Molecular Weight | 525.02 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | 2-[1-[7-tert-butyl-5-(4-chloro-3-fluorophenyl)furo[3,2-b]pyridine-2-carbonyl]-2,2-dimethylpiperidin-4-yl]-N-cyanoacetamide |
| SMILES | CC(C)(C)c1cc(-c2ccc(Cl)c(F)c2)nc2cc(C(=O)N3CCC(CC(=O)NC#N)CC3(C)C)oc12 |
| InChI | InChI=1S/C28H30ClFN4O3/c1-27(2,3)18-12-21(17-6-7-19(29)20(30)11-17)33-22-13-23(37-25(18)22)26(36)34-9-8-16(14-28(34,4)5)10-24(35)32-15-31/h6-7,11-13,16H,8-10,14H2,1-5H3,(H,32,35) |
| InChIKey | GQKGDDXVLGMYEY-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 99.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.02 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|