C33H29F10N9O2 — CID 122574523
1-(3-aminopropyl)-6-[3-fluoro-2-(2,2,3,3,3-pentafluoropropoxy)phenyl]indazol-3-amine;6-[2-fluoro-6-(2,2,2-trifluoroethoxy)phenyl]-1-methylpyrazolo[3,4-b]pyrazin-3-amine (PubChem CID 122574523) has the molecular formula C33H29F10N9O2 and a molecular weight of 773.64 g/mol. Its IUPAC name is 1-(3-aminopropyl)-6-[3-fluoro-2-(2,2,3,3,3-pentafluoropropoxy)phenyl]indazol-3-amine;6-[2-fluoro-6-(2,2,2-trifluoroethoxy)phenyl]-1-methylpyrazolo[3,4-b]pyrazin-3-amine.
| Compound Name | 1-(3-aminopropyl)-6-[3-fluoro-2-(2,2,3,3,3-pentafluoropropoxy)phenyl]indazol-3-amine;6-[2-fluoro-6-(2,2,2-trifluoroethoxy)phenyl]-1-methylpyrazolo[3,4-b]pyrazin-3-amine |
|---|---|
| PubChem CID | 122574523 |
| Molecular Formula | C33H29F10N9O2 |
| Molecular Weight | 773.64 g/mol |
| Exact Mass | 773.23 |
| IUPAC Name | 1-(3-aminopropyl)-6-[3-fluoro-2-(2,2,3,3,3-pentafluoropropoxy)phenyl]indazol-3-amine;6-[2-fluoro-6-(2,2,2-trifluoroethoxy)phenyl]-1-methylpyrazolo[3,4-b]pyrazin-3-amine |
| SMILES | Cn1nc(N)c2ncc(-c3c(F)cccc3OCC(F)(F)F)nc21.NCCCn1nc(N)c2ccc(-c3cccc(F)c3OCC(F)(F)C(F)(F)F)cc21 |
| InChI | InChI=1S/C19H18F6N4O.C14H11F4N5O/c20-14-4-1-3-12(16(14)30-10-18(21,22)19(23,24)25)11-5-6-13-15(9-11)29(8-2-7-26)28-17(13)27;1-23-13-11(12(19)22-23)20-5-8(21-13)10-7(15)3-2-4-9(10)24-6-14(16,17)18/h1,3-6,9H,2,7-8,10,26H2,(H2,27,28);2-5H,6H2,1H3,(H2,19,22) |
| InChIKey | CQRVNVWZTCKSFF-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 157.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.64 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|