C7H17NO4 — CID 122574555
(2R,3S,4R,5S)-3-(aminomethyl)hexane-2,3,4,5-tetrol (PubChem CID 122574555) has the molecular formula C7H17NO4 and a molecular weight of 179.22 g/mol. Its IUPAC name is (2R,3S,4R,5S)-3-(aminomethyl)hexane-2,3,4,5-tetrol.
| Compound Name | (2R,3S,4R,5S)-3-(aminomethyl)hexane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 122574555 |
| Molecular Formula | C7H17NO4 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | (2R,3S,4R,5S)-3-(aminomethyl)hexane-2,3,4,5-tetrol |
| SMILES | C[C@H](O)[C@@H](O)[C@](O)(CN)[C@@H](C)O |
| InChI | InChI=1S/C7H17NO4/c1-4(9)6(11)7(12,3-8)5(2)10/h4-6,9-12H,3,8H2,1-2H3/t4-,5+,6+,7-/m0/s1 |
| InChIKey | CXASPKDUFRBTRC-WNJXEPBRSA-N |
| XLogP | -2.20 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |