C19H24F6N4O4S — CID 122574820
tert-butyl-[[5-methyl-2,4-dioxo-3-(1,1,1-trifluoropropan-2-yl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methylamino]carbamic acid (PubChem CID 122574820) has the molecular formula C19H24F6N4O4S and a molecular weight of 518.48 g/mol. Its IUPAC name is tert-butyl-[[5-methyl-2,4-dioxo-3-(1,1,1-trifluoropropan-2-yl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methylamino]carbamic acid.
| Compound Name | tert-butyl-[[5-methyl-2,4-dioxo-3-(1,1,1-trifluoropropan-2-yl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methylamino]carbamic acid |
|---|---|
| PubChem CID | 122574820 |
| Molecular Formula | C19H24F6N4O4S |
| Molecular Weight | 518.48 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | tert-butyl-[[5-methyl-2,4-dioxo-3-(1,1,1-trifluoropropan-2-yl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methylamino]carbamic acid |
| SMILES | Cc1c(CNN(C(=O)O)C(C)(C)C)sc2c1c(=O)n(C(C)C(F)(F)F)c(=O)n2CCC(F)(F)F |
| InChI | InChI=1S/C19H24F6N4O4S/c1-9-11(8-26-29(16(32)33)17(3,4)5)34-14-12(9)13(30)28(10(2)19(23,24)25)15(31)27(14)7-6-18(20,21)22/h10,26H,6-8H2,1-5H3,(H,32,33) |
| InChIKey | NSEKQUMRSDFJJD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|