C15H18F3N5O4S — CID 122574837
N-[carbamoyl-[[3-ethyl-5-methyl-2,4-dioxo-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methyl]amino]formamide (PubChem CID 122574837) has the molecular formula C15H18F3N5O4S and a molecular weight of 421.40 g/mol. Its IUPAC name is N-[carbamoyl-[[3-ethyl-5-methyl-2,4-dioxo-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methyl]amino]formamide.
| Compound Name | N-[carbamoyl-[[3-ethyl-5-methyl-2,4-dioxo-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methyl]amino]formamide |
|---|---|
| PubChem CID | 122574837 |
| Molecular Formula | C15H18F3N5O4S |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | N-[carbamoyl-[[3-ethyl-5-methyl-2,4-dioxo-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methyl]amino]formamide |
| SMILES | CCn1c(=O)c2c(C)c(CN(NC=O)C(N)=O)sc2n(CCC(F)(F)F)c1=O |
| InChI | InChI=1S/C15H18F3N5O4S/c1-3-21-11(25)10-8(2)9(6-23(13(19)26)20-7-24)28-12(10)22(14(21)27)5-4-15(16,17)18/h7H,3-6H2,1-2H3,(H2,19,26)(H,20,24) |
| InChIKey | DKMVSLREUMSIMB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|