C18H22F6N4O4S — CID 122575171
tert-butyl-[[5-methyl-2,4-dioxo-3-(2,2,2-trifluoroethyl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methylamino]carbamic acid (PubChem CID 122575171) has the molecular formula C18H22F6N4O4S and a molecular weight of 504.45 g/mol. Its IUPAC name is tert-butyl-[[5-methyl-2,4-dioxo-3-(2,2,2-trifluoroethyl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methylamino]carbamic acid.
| Compound Name | tert-butyl-[[5-methyl-2,4-dioxo-3-(2,2,2-trifluoroethyl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methylamino]carbamic acid |
|---|---|
| PubChem CID | 122575171 |
| Molecular Formula | C18H22F6N4O4S |
| Molecular Weight | 504.45 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | tert-butyl-[[5-methyl-2,4-dioxo-3-(2,2,2-trifluoroethyl)-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methylamino]carbamic acid |
| SMILES | Cc1c(CNN(C(=O)O)C(C)(C)C)sc2c1c(=O)n(CC(F)(F)F)c(=O)n2CCC(F)(F)F |
| InChI | InChI=1S/C18H22F6N4O4S/c1-9-10(7-25-28(15(31)32)16(2,3)4)33-13-11(9)12(29)27(8-18(22,23)24)14(30)26(13)6-5-17(19,20)21/h25H,5-8H2,1-4H3,(H,31,32) |
| InChIKey | MRYUHNBSXLXYKW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|