C21H31F3N4O4S — CID 122575394
tert-butyl-[[3-(2,2-dimethylpropyl)-5-methyl-2,4-dioxo-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methylamino]carbamic acid (PubChem CID 122575394) has the molecular formula C21H31F3N4O4S and a molecular weight of 492.56 g/mol. Its IUPAC name is tert-butyl-[[3-(2,2-dimethylpropyl)-5-methyl-2,4-dioxo-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methylamino]carbamic acid.
| Compound Name | tert-butyl-[[3-(2,2-dimethylpropyl)-5-methyl-2,4-dioxo-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methylamino]carbamic acid |
|---|---|
| PubChem CID | 122575394 |
| Molecular Formula | C21H31F3N4O4S |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | tert-butyl-[[3-(2,2-dimethylpropyl)-5-methyl-2,4-dioxo-1-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-6-yl]methylamino]carbamic acid |
| SMILES | Cc1c(CNN(C(=O)O)C(C)(C)C)sc2c1c(=O)n(CC(C)(C)C)c(=O)n2CCC(F)(F)F |
| InChI | InChI=1S/C21H31F3N4O4S/c1-12-13(10-25-28(18(31)32)20(5,6)7)33-16-14(12)15(29)27(11-19(2,3)4)17(30)26(16)9-8-21(22,23)24/h25H,8-11H2,1-7H3,(H,31,32) |
| InChIKey | KXYICXUEVWOSMN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|