C22H26N2O6 — CID 122575700
1-ethenyl-3-[(Z)-2-(1-ethenyl-5-ethyl-4,6-dioxo-1,3,3a,6a-tetrahydrofuro[3,4-c]pyrrol-3-yl)ethenyl]-5-ethyl-1,3,3a,6a-tetrahydrofuro[3,4-c]pyrrole-4,6-dione (PubChem CID 122575700) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is 1-ethenyl-3-[(Z)-2-(1-ethenyl-5-ethyl-4,6-dioxo-1,3,3a,6a-tetrahydrofuro[3,4-c]pyrrol-3-yl)ethenyl]-5-ethyl-1,3,3a,6a-tetrahydrofuro[3,4-c]pyrrole-4,6-dione.
| Compound Name | 1-ethenyl-3-[(Z)-2-(1-ethenyl-5-ethyl-4,6-dioxo-1,3,3a,6a-tetrahydrofuro[3,4-c]pyrrol-3-yl)ethenyl]-5-ethyl-1,3,3a,6a-tetrahydrofuro[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 122575700 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 1-ethenyl-3-[(Z)-2-(1-ethenyl-5-ethyl-4,6-dioxo-1,3,3a,6a-tetrahydrofuro[3,4-c]pyrrol-3-yl)ethenyl]-5-ethyl-1,3,3a,6a-tetrahydrofuro[3,4-c]pyrrole-4,6-dione |
| SMILES | C=CC1OC(/C=C\C2OC(C=C)C3C(=O)N(CC)C(=O)C23)C2C(=O)N(CC)C(=O)C12 |
| InChI | InChI=1S/C22H26N2O6/c1-5-11-15-17(21(27)23(7-3)19(15)25)13(29-11)9-10-14-18-16(12(6-2)30-14)20(26)24(8-4)22(18)28/h5-6,9-18H,1-2,7-8H2,3-4H3/b10-9- |
| InChIKey | ZLZOISGJEGMMRH-KTKRTIGZSA-N |
| XLogP | 0.69 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|