About N-(1,3-benzodioxol-5-yl)-1,3-dimethyl-4-nitropyrazole-5-carboxamide
N-(1,3-benzodioxol-5-yl)-1,3-dimethyl-4-nitropyrazole-5-carboxamide (PubChem CID 1225758) has the molecular formula C13H12N4O5
and a molecular weight of 304.26 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1,3-dimethyl-4-nitropyrazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(1,3-benzodioxol-5-yl)-1,3-dimethyl-4-nitropyrazole-5-carboxamide |
| PubChem CID | 1225758 |
| Molecular Formula | C13H12N4O5 |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1,3-dimethyl-4-nitropyrazole-5-carboxamide |
| SMILES | Cc1nn(C)c(C(=O)Nc2ccc3c(c2)OCO3)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H12N4O5/c1-7-11(17(19)20)12(16(2)15-7)13(18)14-8-3-4-9-10(5-8)22-6-21-9/h3-5H,6H2,1-2H3,(H,14,18) |
| InChIKey | FPELDEJNSUGPSU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3-benzodioxol-5-yl)-1,3-dimethyl-4-nitropyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-benzodioxol-5-yl)-1,3-dimethyl-4-nitropyrazole-5-carboxamide?
The IUPAC name of N-(1,3-benzodioxol-5-yl)-1,3-dimethyl-4-nitropyrazole-5-carboxamide (CID 1225758) is N-(1,3-benzodioxol-5-yl)-1,3-dimethyl-4-nitropyrazole-5-carboxamide.
What is the SMILES notation for N-(1,3-benzodioxol-5-yl)-1,3-dimethyl-4-nitropyrazole-5-carboxamide?
The canonical SMILES for N-(1,3-benzodioxol-5-yl)-1,3-dimethyl-4-nitropyrazole-5-carboxamide is Cc1nn(C)c(C(=O)Nc2ccc3c(c2)OCO3)c1[N+](=O)[O-].
What is the InChIKey of N-(1,3-benzodioxol-5-yl)-1,3-dimethyl-4-nitropyrazole-5-carboxamide?
The InChIKey is FPELDEJNSUGPSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4O5/c1-7-11(17(19)20)12(16(2)15-7)13(18)14-8-3-4-9-10(5-8)22-6-21-9/h3-5H,6H2,1-2H3,(H,14,18).
What are the key properties of N-(1,3-benzodioxol-5-yl)-1,3-dimethyl-4-nitropyrazole-5-carboxamide?
N-(1,3-benzodioxol-5-yl)-1,3-dimethyl-4-nitropyrazole-5-carboxamide has a molecular weight of 304.26 g/mol, XLogP of 1.62, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-benzodioxol-5-yl)-1,3-dimethyl-4-nitropyrazole-5-carboxamide is sourced from PubChem (CID 1225758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).