C10H14F3NO — CID 122575868
5,6-dimethyl-1-(2,2,2-trifluoroethyl)-5,6-dihydro-2H-azepin-7-one (PubChem CID 122575868) has the molecular formula C10H14F3NO and a molecular weight of 221.22 g/mol. Its IUPAC name is 5,6-dimethyl-1-(2,2,2-trifluoroethyl)-5,6-dihydro-2H-azepin-7-one.
| Compound Name | 5,6-dimethyl-1-(2,2,2-trifluoroethyl)-5,6-dihydro-2H-azepin-7-one |
|---|---|
| PubChem CID | 122575868 |
| Molecular Formula | C10H14F3NO |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 5,6-dimethyl-1-(2,2,2-trifluoroethyl)-5,6-dihydro-2H-azepin-7-one |
| SMILES | CC1C=CCN(C(=O)C1C)CC(F)(F)F |
| InChI | InChI=1S/C10H14F3NO/c1-7-4-3-5-14(6-10(11,12)13)9(15)8(7)2/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | SDPJSGVEXGTOLE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 20.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | 272 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|