C19H24N2O2 — CID 122576111
3-[5-[(1R,2S,5S)-2-bicyclo[3.1.0]hexanyl]pentyl]-7-hydroxy-1H-quinoxalin-2-one (PubChem CID 122576111) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 3-[5-[(1R,2S,5S)-2-bicyclo[3.1.0]hexanyl]pentyl]-7-hydroxy-1H-quinoxalin-2-one.
| Compound Name | 3-[5-[(1R,2S,5S)-2-bicyclo[3.1.0]hexanyl]pentyl]-7-hydroxy-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 122576111 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 3-[5-[(1R,2S,5S)-2-bicyclo[3.1.0]hexanyl]pentyl]-7-hydroxy-1H-quinoxalin-2-one |
| SMILES | O=c1[nH]c2cc(O)ccc2nc1CCCCC[C@H]1CC[C@H]2C[C@@H]12 |
| InChI | InChI=1S/C19H24N2O2/c22-14-8-9-16-18(11-14)21-19(23)17(20-16)5-3-1-2-4-12-6-7-13-10-15(12)13/h8-9,11-13,15,22H,1-7,10H2,(H,21,23)/t12-,13-,15-/m0/s1 |
| InChIKey | FMFKHHLBYHOTAH-YDHLFZDLSA-N |
| XLogP | 3.78 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|