C26H28F3N3O5 — CID 122576532
(E)-1-[4-[4-[4-(trifluoromethyl)phenyl]imidazol-1-yl]phenyl]-N-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxymethanimine (PubChem CID 122576532) has the molecular formula C26H28F3N3O5 and a molecular weight of 519.52 g/mol. Its IUPAC name is (E)-1-[4-[4-[4-(trifluoromethyl)phenyl]imidazol-1-yl]phenyl]-N-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxymethanimine.
| Compound Name | (E)-1-[4-[4-[4-(trifluoromethyl)phenyl]imidazol-1-yl]phenyl]-N-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxymethanimine |
|---|---|
| PubChem CID | 122576532 |
| Molecular Formula | C26H28F3N3O5 |
| Molecular Weight | 519.52 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | (E)-1-[4-[4-[4-(trifluoromethyl)phenyl]imidazol-1-yl]phenyl]-N-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxymethanimine |
| SMILES | CO[C@@H]1[C@@H](OC)[C@H](C)O[C@@H](O/N=C/c2ccc(-n3cnc(-c4ccc(C(F)(F)F)cc4)c3)cc2)[C@@H]1OC |
| InChI | InChI=1S/C26H28F3N3O5/c1-16-22(33-2)23(34-3)24(35-4)25(36-16)37-31-13-17-5-11-20(12-6-17)32-14-21(30-15-32)18-7-9-19(10-8-18)26(27,28)29/h5-16,22-25H,1-4H3/b31-13+/t16-,22-,23+,24+,25-/m0/s1 |
| InChIKey | SCYZBTDEHGZPLS-AGQSTXDSSA-N |
| XLogP | 4.70 |
| TPSA | 76.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|