C32H36N4O3S — CID 122576926
benzyl (1R,8S)-4-[4-[(4-methoxy-2-methylphenyl)carbamothioyl]piperazin-1-yl]-9-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene-9-carboxylate (PubChem CID 122576926) has the molecular formula C32H36N4O3S and a molecular weight of 556.73 g/mol. Its IUPAC name is benzyl (1R,8S)-4-[4-[(4-methoxy-2-methylphenyl)carbamothioyl]piperazin-1-yl]-9-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene-9-carboxylate.
| Compound Name | benzyl (1R,8S)-4-[4-[(4-methoxy-2-methylphenyl)carbamothioyl]piperazin-1-yl]-9-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene-9-carboxylate |
|---|---|
| PubChem CID | 122576926 |
| Molecular Formula | C32H36N4O3S |
| Molecular Weight | 556.73 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | benzyl (1R,8S)-4-[4-[(4-methoxy-2-methylphenyl)carbamothioyl]piperazin-1-yl]-9-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene-9-carboxylate |
| SMILES | COc1ccc(NC(=S)N2CCN(c3ccc4c(c3)[C@@H]3CCN(C(=O)OCc5ccccc5)[C@H]4C3)CC2)c(C)c1 |
| InChI | InChI=1S/C32H36N4O3S/c1-22-18-26(38-2)9-11-29(22)33-31(40)35-16-14-34(15-17-35)25-8-10-27-28(20-25)24-12-13-36(30(27)19-24)32(37)39-21-23-6-4-3-5-7-23/h3-11,18,20,24,30H,12-17,19,21H2,1-2H3,(H,33,40)/t24-,30+/m1/s1 |
| InChIKey | XZAZIDWXFMKJKA-HLADLETHSA-N |
| XLogP | 6.09 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.73 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|