C13H23N5O3 — CID 122577476
(2S)-5-(carbamoylamino)-2-[4-[(2S)-3-methylbutan-2-yl]triazol-1-yl]pentanoic acid (PubChem CID 122577476) has the molecular formula C13H23N5O3 and a molecular weight of 297.36 g/mol. Its IUPAC name is (2S)-5-(carbamoylamino)-2-[4-[(2S)-3-methylbutan-2-yl]triazol-1-yl]pentanoic acid.
| Compound Name | (2S)-5-(carbamoylamino)-2-[4-[(2S)-3-methylbutan-2-yl]triazol-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 122577476 |
| Molecular Formula | C13H23N5O3 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | (2S)-5-(carbamoylamino)-2-[4-[(2S)-3-methylbutan-2-yl]triazol-1-yl]pentanoic acid |
| SMILES | CC(C)C(C)c1cn([C@@H](CCCNC(N)=O)C(=O)O)nn1 |
| InChI | InChI=1S/C13H23N5O3/c1-8(2)9(3)10-7-18(17-16-10)11(12(19)20)5-4-6-15-13(14)21/h7-9,11H,4-6H2,1-3H3,(H,19,20)(H3,14,15,21)/t9?,11-/m0/s1 |
| InChIKey | MMNIQTZJYKRUCL-UMJHXOGRSA-N |
| XLogP | 1.11 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|