About N-[3-(buta-1,3-dien-2-ylamino)propyl]-2-methylpropanamide
N-[3-(buta-1,3-dien-2-ylamino)propyl]-2-methylpropanamide (PubChem CID 122577624) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is N-[3-(buta-1,3-dien-2-ylamino)propyl]-2-methylpropanamide.
Molecular Properties
| Compound Name | N-[3-(buta-1,3-dien-2-ylamino)propyl]-2-methylpropanamide |
| PubChem CID | 122577624 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | N-[3-(buta-1,3-dien-2-ylamino)propyl]-2-methylpropanamide |
| SMILES | C=CC(=C)NCCCNC(=O)C(C)C |
| InChI | InChI=1S/C11H20N2O/c1-5-10(4)12-7-6-8-13-11(14)9(2)3/h5,9,12H,1,4,6-8H2,2-3H3,(H,13,14) |
| InChIKey | JSWDIKVTLXEKAE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(buta-1,3-dien-2-ylamino)propyl]-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(buta-1,3-dien-2-ylamino)propyl]-2-methylpropanamide?
The IUPAC name of N-[3-(buta-1,3-dien-2-ylamino)propyl]-2-methylpropanamide (CID 122577624) is N-[3-(buta-1,3-dien-2-ylamino)propyl]-2-methylpropanamide.
What is the SMILES notation for N-[3-(buta-1,3-dien-2-ylamino)propyl]-2-methylpropanamide?
The canonical SMILES for N-[3-(buta-1,3-dien-2-ylamino)propyl]-2-methylpropanamide is C=CC(=C)NCCCNC(=O)C(C)C.
What is the InChIKey of N-[3-(buta-1,3-dien-2-ylamino)propyl]-2-methylpropanamide?
The InChIKey is JSWDIKVTLXEKAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O/c1-5-10(4)12-7-6-8-13-11(14)9(2)3/h5,9,12H,1,4,6-8H2,2-3H3,(H,13,14).
What are the key properties of N-[3-(buta-1,3-dien-2-ylamino)propyl]-2-methylpropanamide?
N-[3-(buta-1,3-dien-2-ylamino)propyl]-2-methylpropanamide has a molecular weight of 196.29 g/mol, XLogP of 1.44, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(buta-1,3-dien-2-ylamino)propyl]-2-methylpropanamide is sourced from PubChem (CID 122577624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).