C43H35F3N2O4 — CID 122577802
methyl N-[4-[4-[1,1,1-trifluoro-2-[4-[4-[[methoxy(phenyl)methylidene]amino]phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]benzenecarboximidate (PubChem CID 122577802) has the molecular formula C43H35F3N2O4 and a molecular weight of 700.76 g/mol. Its IUPAC name is methyl N-[4-[4-[1,1,1-trifluoro-2-[4-[4-[[methoxy(phenyl)methylidene]amino]phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]benzenecarboximidate.
| Compound Name | methyl N-[4-[4-[1,1,1-trifluoro-2-[4-[4-[[methoxy(phenyl)methylidene]amino]phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]benzenecarboximidate |
|---|---|
| PubChem CID | 122577802 |
| Molecular Formula | C43H35F3N2O4 |
| Molecular Weight | 700.76 g/mol |
| Exact Mass | 700.25 |
| IUPAC Name | methyl N-[4-[4-[1,1,1-trifluoro-2-[4-[4-[[methoxy(phenyl)methylidene]amino]phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]benzenecarboximidate |
| SMILES | CO/C(=N\c1ccc(Oc2ccc(C(C)(c3ccc(Oc4ccc(/N=C(\OC)c5ccccc5)cc4)cc3)C(F)(F)F)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C43H35F3N2O4/c1-42(43(44,45)46,32-14-22-36(23-15-32)51-38-26-18-34(19-27-38)47-40(49-2)30-10-6-4-7-11-30)33-16-24-37(25-17-33)52-39-28-20-35(21-29-39)48-41(50-3)31-12-8-5-9-13-31/h4-29H,1-3H3/b47-40-,48-41- |
| InChIKey | LCPZSNOGSNGDPE-KOAQIILCSA-N |
| XLogP | 11.59 |
| TPSA | 61.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.76 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|