C26H28F5NO — CID 122578226
5-[[4-(4-ethylcyclohex-2-en-1-yl)cyclohexyl]-difluoromethoxy]-2-(3,4,5-trifluorophenyl)pyridine (PubChem CID 122578226) has the molecular formula C26H28F5NO and a molecular weight of 465.51 g/mol. Its IUPAC name is 5-[[4-(4-ethylcyclohex-2-en-1-yl)cyclohexyl]-difluoromethoxy]-2-(3,4,5-trifluorophenyl)pyridine.
| Compound Name | 5-[[4-(4-ethylcyclohex-2-en-1-yl)cyclohexyl]-difluoromethoxy]-2-(3,4,5-trifluorophenyl)pyridine |
|---|---|
| PubChem CID | 122578226 |
| Molecular Formula | C26H28F5NO |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 5-[[4-(4-ethylcyclohex-2-en-1-yl)cyclohexyl]-difluoromethoxy]-2-(3,4,5-trifluorophenyl)pyridine |
| SMILES | CCC1C=CC(C2CCC(C(F)(F)Oc3ccc(-c4cc(F)c(F)c(F)c4)nc3)CC2)CC1 |
| InChI | InChI=1S/C26H28F5NO/c1-2-16-3-5-17(6-4-16)18-7-9-20(10-8-18)26(30,31)33-21-11-12-24(32-15-21)19-13-22(27)25(29)23(28)14-19/h3,5,11-18,20H,2,4,6-10H2,1H3 |
| InChIKey | AMXVNTNZPBPZKQ-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|