About 6-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]pyrazin-2-amine
6-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]pyrazin-2-amine (PubChem CID 122578336) has the molecular formula C18H13F3N6
and a molecular weight of 370.34 g/mol. Its IUPAC name is 6-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]pyrazin-2-amine.
Molecular Properties
| Compound Name | 6-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]pyrazin-2-amine |
| PubChem CID | 122578336 |
| Molecular Formula | C18H13F3N6 |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 6-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]pyrazin-2-amine |
| SMILES | Cc1nc2ccccn2c1-c1cncc(Nc2ccc(C(F)(F)F)cn2)n1 |
| InChI | InChI=1S/C18H13F3N6/c1-11-17(27-7-3-2-4-16(27)24-11)13-9-22-10-15(25-13)26-14-6-5-12(8-23-14)18(19,20)21/h2-10H,1H3,(H,23,25,26) |
| InChIKey | JWBPWNBKSDLNPH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]pyrazin-2-amine?
The IUPAC name of 6-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]pyrazin-2-amine (CID 122578336) is 6-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]pyrazin-2-amine.
What is the SMILES notation for 6-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]pyrazin-2-amine?
The canonical SMILES for 6-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]pyrazin-2-amine is Cc1nc2ccccn2c1-c1cncc(Nc2ccc(C(F)(F)F)cn2)n1.
What is the InChIKey of 6-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]pyrazin-2-amine?
The InChIKey is JWBPWNBKSDLNPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F3N6/c1-11-17(27-7-3-2-4-16(27)24-11)13-9-22-10-15(25-13)26-14-6-5-12(8-23-14)18(19,20)21/h2-10H,1H3,(H,23,25,26).
What are the key properties of 6-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]pyrazin-2-amine?
6-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]pyrazin-2-amine has a molecular weight of 370.34 g/mol, XLogP of 4.26, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-[5-(trifluoromethyl)-2-pyridinyl]pyrazin-2-amine is sourced from PubChem (CID 122578336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).