C17H12Cl2N4O3 — CID 1225788
N-(2,5-dichlorophenyl)-4-[(4-nitropyrazol-1-yl)methyl]benzamide (PubChem CID 1225788) has the molecular formula C17H12Cl2N4O3 and a molecular weight of 391.21 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-4-[(4-nitropyrazol-1-yl)methyl]benzamide.
| Compound Name | N-(2,5-dichlorophenyl)-4-[(4-nitropyrazol-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 1225788 |
| Molecular Formula | C17H12Cl2N4O3 |
| Molecular Weight | 391.21 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | N-(2,5-dichlorophenyl)-4-[(4-nitropyrazol-1-yl)methyl]benzamide |
| SMILES | O=C(Nc1cc(Cl)ccc1Cl)c1ccc(Cn2cc([N+](=O)[O-])cn2)cc1 |
| InChI | InChI=1S/C17H12Cl2N4O3/c18-13-5-6-15(19)16(7-13)21-17(24)12-3-1-11(2-4-12)9-22-10-14(8-20-22)23(25)26/h1-8,10H,9H2,(H,21,24) |
| InChIKey | ZVRSZLXXWILANL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.21 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|