About ethyl 4-(5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidine-1-carboxylate
ethyl 4-(5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidine-1-carboxylate (PubChem CID 122579357) has the molecular formula C20H23N3O2
and a molecular weight of 337.42 g/mol. Its IUPAC name is ethyl 4-(5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidine-1-carboxylate |
| PubChem CID | 122579357 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | ethyl 4-(5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(=C2c3ccccc3CCn3ccnc32)CC1 |
| InChI | InChI=1S/C20H23N3O2/c1-2-25-20(24)23-12-8-16(9-13-23)18-17-6-4-3-5-15(17)7-11-22-14-10-21-19(18)22/h3-6,10,14H,2,7-9,11-13H2,1H3 |
| InChIKey | UFWHHEFDNNXVSN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-(5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidine-1-carboxylate?
The IUPAC name of ethyl 4-(5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidine-1-carboxylate (CID 122579357) is ethyl 4-(5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidine-1-carboxylate.
What is the SMILES notation for ethyl 4-(5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidine-1-carboxylate?
The canonical SMILES for ethyl 4-(5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidine-1-carboxylate is CCOC(=O)N1CCC(=C2c3ccccc3CCn3ccnc32)CC1.
What is the InChIKey of ethyl 4-(5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidine-1-carboxylate?
The InChIKey is UFWHHEFDNNXVSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N3O2/c1-2-25-20(24)23-12-8-16(9-13-23)18-17-6-4-3-5-15(17)7-11-22-14-10-21-19(18)22/h3-6,10,14H,2,7-9,11-13H2,1H3.
What are the key properties of ethyl 4-(5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidine-1-carboxylate?
ethyl 4-(5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidine-1-carboxylate has a molecular weight of 337.42 g/mol, XLogP of 3.49, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidine-1-carboxylate is sourced from PubChem (CID 122579357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).