C18H19F3N4O6S — CID 122579615
[(3R,5S,6S)-4-acetyloxy-2-(azidomethyl)-6-phenylsulfanyl-5-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate (PubChem CID 122579615) has the molecular formula C18H19F3N4O6S and a molecular weight of 476.43 g/mol. Its IUPAC name is [(3R,5S,6S)-4-acetyloxy-2-(azidomethyl)-6-phenylsulfanyl-5-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate.
| Compound Name | [(3R,5S,6S)-4-acetyloxy-2-(azidomethyl)-6-phenylsulfanyl-5-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 122579615 |
| Molecular Formula | C18H19F3N4O6S |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | [(3R,5S,6S)-4-acetyloxy-2-(azidomethyl)-6-phenylsulfanyl-5-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate |
| SMILES | CC(=O)OC1[C@H](OC(C)=O)C(CN=[N+]=[N-])O[C@@H](Sc2ccccc2)[C@H]1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C18H19F3N4O6S/c1-9(26)29-14-12(8-23-25-22)31-16(32-11-6-4-3-5-7-11)13(15(14)30-10(2)27)24-17(28)18(19,20)21/h3-7,12-16H,8H2,1-2H3,(H,24,28)/t12?,13-,14+,15?,16-/m0/s1 |
| InChIKey | IUAHNKCORPDCFI-BJWPUDQFSA-N |
| XLogP | 2.72 |
| TPSA | 139.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|