About 2-[[3,6-dicyano-5-(2-sulfinoethylamino)pyrazin-2-yl]amino]ethanesulfonic acid
2-[[3,6-dicyano-5-(2-sulfinoethylamino)pyrazin-2-yl]amino]ethanesulfonic acid (PubChem CID 122580429) has the molecular formula C10H12N6O5S2
and a molecular weight of 360.38 g/mol. Its IUPAC name is 2-[[3,6-dicyano-5-(2-sulfinoethylamino)pyrazin-2-yl]amino]ethanesulfonic acid.
Molecular Properties
| Compound Name | 2-[[3,6-dicyano-5-(2-sulfinoethylamino)pyrazin-2-yl]amino]ethanesulfonic acid |
| PubChem CID | 122580429 |
| Molecular Formula | C10H12N6O5S2 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 2-[[3,6-dicyano-5-(2-sulfinoethylamino)pyrazin-2-yl]amino]ethanesulfonic acid |
| SMILES | N#Cc1nc(NCCS(=O)(=O)O)c(C#N)nc1NCCS(=O)O |
| InChI | InChI=1S/C10H12N6O5S2/c11-5-7-9(13-1-3-22(17)18)15-8(6-12)10(16-7)14-2-4-23(19,20)21/h1-4H2,(H,13,15)(H,14,16)(H,17,18)(H,19,20,21) |
| InChIKey | PENKDZVZHAOFMT-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 189.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[3,6-dicyano-5-(2-sulfinoethylamino)pyrazin-2-yl]amino]ethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3,6-dicyano-5-(2-sulfinoethylamino)pyrazin-2-yl]amino]ethanesulfonic acid?
The IUPAC name of 2-[[3,6-dicyano-5-(2-sulfinoethylamino)pyrazin-2-yl]amino]ethanesulfonic acid (CID 122580429) is 2-[[3,6-dicyano-5-(2-sulfinoethylamino)pyrazin-2-yl]amino]ethanesulfonic acid.
What is the SMILES notation for 2-[[3,6-dicyano-5-(2-sulfinoethylamino)pyrazin-2-yl]amino]ethanesulfonic acid?
The canonical SMILES for 2-[[3,6-dicyano-5-(2-sulfinoethylamino)pyrazin-2-yl]amino]ethanesulfonic acid is N#Cc1nc(NCCS(=O)(=O)O)c(C#N)nc1NCCS(=O)O.
What is the InChIKey of 2-[[3,6-dicyano-5-(2-sulfinoethylamino)pyrazin-2-yl]amino]ethanesulfonic acid?
The InChIKey is PENKDZVZHAOFMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N6O5S2/c11-5-7-9(13-1-3-22(17)18)15-8(6-12)10(16-7)14-2-4-23(19,20)21/h1-4H2,(H,13,15)(H,14,16)(H,17,18)(H,19,20,21).
What are the key properties of 2-[[3,6-dicyano-5-(2-sulfinoethylamino)pyrazin-2-yl]amino]ethanesulfonic acid?
2-[[3,6-dicyano-5-(2-sulfinoethylamino)pyrazin-2-yl]amino]ethanesulfonic acid has a molecular weight of 360.38 g/mol, XLogP of -0.85, 8 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3,6-dicyano-5-(2-sulfinoethylamino)pyrazin-2-yl]amino]ethanesulfonic acid is sourced from PubChem (CID 122580429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).