C35H58O6 — CID 122580466
(2S,7E,9R,10R,12R,14S,15E,17E,19E,21S)-9-hydroxy-1-[(3S)-3-hydroxycyclohexyl]-10,21-dimethoxy-2,8,12,14,20-pentamethyldocosa-7,15,17,19-tetraene-5,11-dione (PubChem CID 122580466) has the molecular formula C35H58O6 and a molecular weight of 574.84 g/mol. Its IUPAC name is (2S,7E,9R,10R,12R,14S,15E,17E,19E,21S)-9-hydroxy-1-[(3S)-3-hydroxycyclohexyl]-10,21-dimethoxy-2,8,12,14,20-pentamethyldocosa-7,15,17,19-tetraene-5,11-dione.
| Compound Name | (2S,7E,9R,10R,12R,14S,15E,17E,19E,21S)-9-hydroxy-1-[(3S)-3-hydroxycyclohexyl]-10,21-dimethoxy-2,8,12,14,20-pentamethyldocosa-7,15,17,19-tetraene-5,11-dione |
|---|---|
| PubChem CID | 122580466 |
| Molecular Formula | C35H58O6 |
| Molecular Weight | 574.84 g/mol |
| Exact Mass | 574.42 |
| IUPAC Name | (2S,7E,9R,10R,12R,14S,15E,17E,19E,21S)-9-hydroxy-1-[(3S)-3-hydroxycyclohexyl]-10,21-dimethoxy-2,8,12,14,20-pentamethyldocosa-7,15,17,19-tetraene-5,11-dione |
| SMILES | CO[C@@H](C)/C(C)=C/C=C/C=C/[C@@H](C)C[C@@H](C)C(=O)[C@H](OC)[C@H](O)/C(C)=C/CC(=O)CC[C@H](C)CC1CCC[C@H](O)C1 |
| InChI | InChI=1S/C35H58O6/c1-24(13-10-9-11-14-26(3)29(6)40-7)21-28(5)34(39)35(41-8)33(38)27(4)18-20-31(36)19-17-25(2)22-30-15-12-16-32(37)23-30/h9-11,13-14,18,24-25,28-30,32-33,35,37-38H,12,15-17,19-23H2,1-8H3/b11-9+,13-10+,26-14+,27-18+/t24-,25+,28-,29+,30?,32+,33-,35-/m1/s1 |
| InChIKey | ADQXQWJPRPMSJZ-KLECOACQSA-N |
| XLogP | 6.95 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.84 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|