C46H83N2O4P — CID 122581116
3-[[di(propan-2-yl)amino]-[8-[[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy]octoxy]phosphanyl]oxypropanenitrile (PubChem CID 122581116) has the molecular formula C46H83N2O4P and a molecular weight of 759.15 g/mol. Its IUPAC name is 3-[[di(propan-2-yl)amino]-[8-[[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy]octoxy]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[di(propan-2-yl)amino]-[8-[[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy]octoxy]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 122581116 |
| Molecular Formula | C46H83N2O4P |
| Molecular Weight | 759.15 g/mol |
| Exact Mass | 758.61 |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-[8-[[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy]octoxy]phosphanyl]oxypropanenitrile |
| SMILES | Cc1c(C)c2c(c(C)c1OCCCCCCCCOP(OCCC#N)N(C(C)C)C(C)C)CC[C@@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)O2 |
| InChI | InChI=1S/C46H83N2O4P/c1-35(2)23-19-24-38(7)25-20-26-39(8)27-21-29-46(12)30-28-43-42(11)44(40(9)41(10)45(43)52-46)49-32-17-15-13-14-16-18-33-50-53(51-34-22-31-47)48(36(3)4)37(5)6/h35-39H,13-30,32-34H2,1-12H3/t38-,39-,46-,53?/m1/s1 |
| InChIKey | XMYRDDZYHDSHBJ-VWWYJKIISA-N |
| XLogP | 14.15 |
| TPSA | 63.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.15 |
| LogP ≤ 5 | 14.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|