C7H15O18PS2 — CID 122581211
[(2R,5R,6S)-5-hydroperoxy-3-methoxy-2,4-disulfooxy-6-(trioxidanyl)cyclohexyl] dihydrogen phosphate (PubChem CID 122581211) has the molecular formula C7H15O18PS2 and a molecular weight of 482.29 g/mol. Its IUPAC name is [(2R,5R,6S)-5-hydroperoxy-3-methoxy-2,4-disulfooxy-6-(trioxidanyl)cyclohexyl] dihydrogen phosphate.
| Compound Name | [(2R,5R,6S)-5-hydroperoxy-3-methoxy-2,4-disulfooxy-6-(trioxidanyl)cyclohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 122581211 |
| Molecular Formula | C7H15O18PS2 |
| Molecular Weight | 482.29 g/mol |
| Exact Mass | 481.94 |
| IUPAC Name | [(2R,5R,6S)-5-hydroperoxy-3-methoxy-2,4-disulfooxy-6-(trioxidanyl)cyclohexyl] dihydrogen phosphate |
| SMILES | COC1C(OS(=O)(=O)O)[C@H](OO)[C@H](OOO)C(OP(=O)(O)O)[C@@H]1OS(=O)(=O)O |
| InChI | InChI=1S/C7H15O18PS2/c1-19-2-6(23-27(13,14)15)3(20-8)4(21-25-9)5(22-26(10,11)12)7(2)24-28(16,17)18/h2-9H,1H3,(H2,10,11,12)(H,13,14,15)(H,16,17,18)/t2?,3-,4+,5?,6?,7-/m1/s1 |
| InChIKey | OOFZOTYVRSWQOJ-DEOYMJJUSA-N |
| XLogP | -2.48 |
| TPSA | 271.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.29 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|