C7H17O17P3 — CID 122581212
[(1R,4R,5S)-4,5-dihydroperoxy-2-methoxy-3,6-diphosphonooxycyclohexyl] dihydrogen phosphate (PubChem CID 122581212) has the molecular formula C7H17O17P3 and a molecular weight of 466.12 g/mol. Its IUPAC name is [(1R,4R,5S)-4,5-dihydroperoxy-2-methoxy-3,6-diphosphonooxycyclohexyl] dihydrogen phosphate.
| Compound Name | [(1R,4R,5S)-4,5-dihydroperoxy-2-methoxy-3,6-diphosphonooxycyclohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 122581212 |
| Molecular Formula | C7H17O17P3 |
| Molecular Weight | 466.12 g/mol |
| Exact Mass | 465.97 |
| IUPAC Name | [(1R,4R,5S)-4,5-dihydroperoxy-2-methoxy-3,6-diphosphonooxycyclohexyl] dihydrogen phosphate |
| SMILES | COC1C(OP(=O)(O)O)[C@H](OO)[C@H](OO)C(OP(=O)(O)O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C7H17O17P3/c1-19-2-5(22-25(10,11)12)3(20-8)4(21-9)7(24-27(16,17)18)6(2)23-26(13,14)15/h2-9H,1H3,(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)/t2?,3-,4+,5?,6-,7?/m1/s1 |
| InChIKey | WOVRFEWXFCOPMK-IDRUGBGASA-N |
| XLogP | -1.83 |
| TPSA | 268.43 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.12 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|