C9H18N2 — CID 122581312
2,4,6-trimethylcyclohexene-1,3-diamine (PubChem CID 122581312) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 2,4,6-trimethylcyclohexene-1,3-diamine.
| Compound Name | 2,4,6-trimethylcyclohexene-1,3-diamine |
|---|---|
| PubChem CID | 122581312 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 2,4,6-trimethylcyclohexene-1,3-diamine |
| SMILES | CC1=C(N)C(C)CC(C)C1N |
| InChI | InChI=1S/C9H18N2/c1-5-4-6(2)9(11)7(3)8(5)10/h5-6,8H,4,10-11H2,1-3H3 |
| InChIKey | BMQHMHGEOGFLKM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |