C20H22O — CID 122581565
(4,5-dimethyl-2-tricyclo[6.2.1.02,7]undeca-4,9-dienyl)-phenylmethanone (PubChem CID 122581565) has the molecular formula C20H22O and a molecular weight of 278.39 g/mol. Its IUPAC name is (4,5-dimethyl-2-tricyclo[6.2.1.02,7]undeca-4,9-dienyl)-phenylmethanone.
| Compound Name | (4,5-dimethyl-2-tricyclo[6.2.1.02,7]undeca-4,9-dienyl)-phenylmethanone |
|---|---|
| PubChem CID | 122581565 |
| Molecular Formula | C20H22O |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | (4,5-dimethyl-2-tricyclo[6.2.1.02,7]undeca-4,9-dienyl)-phenylmethanone |
| SMILES | CC1=C(C)CC2(C(=O)c3ccccc3)C3C=CC(C3)C2C1 |
| InChI | InChI=1S/C20H22O/c1-13-10-18-16-8-9-17(11-16)20(18,12-14(13)2)19(21)15-6-4-3-5-7-15/h3-9,16-18H,10-12H2,1-2H3 |
| InChIKey | FHFKBAYKSZNEGD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|