C22H13FN4O — CID 122581984
5-[8-ethynyl-6-(2-fluorophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl]-1,3-oxazole (PubChem CID 122581984) has the molecular formula C22H13FN4O and a molecular weight of 368.37 g/mol. Its IUPAC name is 5-[8-ethynyl-6-(2-fluorophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl]-1,3-oxazole.
| Compound Name | 5-[8-ethynyl-6-(2-fluorophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl]-1,3-oxazole |
|---|---|
| PubChem CID | 122581984 |
| Molecular Formula | C22H13FN4O |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 5-[8-ethynyl-6-(2-fluorophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl]-1,3-oxazole |
| SMILES | C#Cc1ccc2c(c1)C(c1ccccc1F)=NCc1c(-c3cnco3)ncn1-2 |
| InChI | InChI=1S/C22H13FN4O/c1-2-14-7-8-18-16(9-14)21(15-5-3-4-6-17(15)23)25-10-19-22(26-12-27(18)19)20-11-24-13-28-20/h1,3-9,11-13H,10H2 |
| InChIKey | HIRCSKJASDNSMO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 56.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|