C24H19N5O3 — CID 122581985
5-[(4S)-8-cyclopropyl-4-methyl-6-(2-nitrophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl]-1,3-oxazole (PubChem CID 122581985) has the molecular formula C24H19N5O3 and a molecular weight of 425.45 g/mol. Its IUPAC name is 5-[(4S)-8-cyclopropyl-4-methyl-6-(2-nitrophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl]-1,3-oxazole.
| Compound Name | 5-[(4S)-8-cyclopropyl-4-methyl-6-(2-nitrophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl]-1,3-oxazole |
|---|---|
| PubChem CID | 122581985 |
| Molecular Formula | C24H19N5O3 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 5-[(4S)-8-cyclopropyl-4-methyl-6-(2-nitrophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl]-1,3-oxazole |
| SMILES | C[C@@H]1N=C(c2ccccc2[N+](=O)[O-])c2cc(C3CC3)ccc2-n2cnc(-c3cnco3)c21 |
| InChI | InChI=1S/C24H19N5O3/c1-14-24-23(21-11-25-13-32-21)26-12-28(24)19-9-8-16(15-6-7-15)10-18(19)22(27-14)17-4-2-3-5-20(17)29(30)31/h2-5,8-15H,6-7H2,1H3/t14-/m0/s1 |
| InChIKey | HBXXPOTYRKDSCL-AWEZNQCLSA-N |
| XLogP | 5.22 |
| TPSA | 99.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|