C22H13N5O3 — CID 122582088
5-[8-ethynyl-6-(2-nitrophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl]-1,3-oxazole (PubChem CID 122582088) has the molecular formula C22H13N5O3 and a molecular weight of 395.38 g/mol. Its IUPAC name is 5-[8-ethynyl-6-(2-nitrophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl]-1,3-oxazole.
| Compound Name | 5-[8-ethynyl-6-(2-nitrophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl]-1,3-oxazole |
|---|---|
| PubChem CID | 122582088 |
| Molecular Formula | C22H13N5O3 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 5-[8-ethynyl-6-(2-nitrophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl]-1,3-oxazole |
| SMILES | C#Cc1ccc2c(c1)C(c1ccccc1[N+](=O)[O-])=NCc1c(-c3cnco3)ncn1-2 |
| InChI | InChI=1S/C22H13N5O3/c1-2-14-7-8-17-16(9-14)21(15-5-3-4-6-18(15)27(28)29)24-10-19-22(25-12-26(17)19)20-11-23-13-30-20/h1,3-9,11-13H,10H2 |
| InChIKey | IZWLBIIKYYQNPE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 99.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|