About N-[(3S)-2,7-diaminohept-1-en-3-yl]formamide
N-[(3S)-2,7-diaminohept-1-en-3-yl]formamide (PubChem CID 122582267) has the molecular formula C8H17N3O
and a molecular weight of 171.24 g/mol. Its IUPAC name is N-[(3S)-2,7-diaminohept-1-en-3-yl]formamide.
Molecular Properties
| Compound Name | N-[(3S)-2,7-diaminohept-1-en-3-yl]formamide |
| PubChem CID | 122582267 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | N-[(3S)-2,7-diaminohept-1-en-3-yl]formamide |
| SMILES | C=C(N)[C@H](CCCCN)NC=O |
| InChI | InChI=1S/C8H17N3O/c1-7(10)8(11-6-12)4-2-3-5-9/h6,8H,1-5,9-10H2,(H,11,12)/t8-/m0/s1 |
| InChIKey | SUQAOZOAKXMWLT-QMMMGPOBSA-N |
| XLogP | -0.30 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(3S)-2,7-diaminohept-1-en-3-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-2,7-diaminohept-1-en-3-yl]formamide?
The IUPAC name of N-[(3S)-2,7-diaminohept-1-en-3-yl]formamide (CID 122582267) is N-[(3S)-2,7-diaminohept-1-en-3-yl]formamide.
What is the SMILES notation for N-[(3S)-2,7-diaminohept-1-en-3-yl]formamide?
The canonical SMILES for N-[(3S)-2,7-diaminohept-1-en-3-yl]formamide is C=C(N)[C@H](CCCCN)NC=O.
What is the InChIKey of N-[(3S)-2,7-diaminohept-1-en-3-yl]formamide?
The InChIKey is SUQAOZOAKXMWLT-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H17N3O/c1-7(10)8(11-6-12)4-2-3-5-9/h6,8H,1-5,9-10H2,(H,11,12)/t8-/m0/s1.
What are the key properties of N-[(3S)-2,7-diaminohept-1-en-3-yl]formamide?
N-[(3S)-2,7-diaminohept-1-en-3-yl]formamide has a molecular weight of 171.24 g/mol, XLogP of -0.30, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-2,7-diaminohept-1-en-3-yl]formamide is sourced from PubChem (CID 122582267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).