About 2-(5,5-dimethyl-2-prop-1-en-2-ylcyclohexyl)oxyethanol
2-(5,5-dimethyl-2-prop-1-en-2-ylcyclohexyl)oxyethanol (PubChem CID 122582289) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is 2-(5,5-dimethyl-2-prop-1-en-2-ylcyclohexyl)oxyethanol.
Molecular Properties
| Compound Name | 2-(5,5-dimethyl-2-prop-1-en-2-ylcyclohexyl)oxyethanol |
| PubChem CID | 122582289 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 2-(5,5-dimethyl-2-prop-1-en-2-ylcyclohexyl)oxyethanol |
| SMILES | C=C(C)C1CCC(C)(C)CC1OCCO |
| InChI | InChI=1S/C13H24O2/c1-10(2)11-5-6-13(3,4)9-12(11)15-8-7-14/h11-12,14H,1,5-9H2,2-4H3 |
| InChIKey | FJROGINBZQAAPD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(5,5-dimethyl-2-prop-1-en-2-ylcyclohexyl)oxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,5-dimethyl-2-prop-1-en-2-ylcyclohexyl)oxyethanol?
The IUPAC name of 2-(5,5-dimethyl-2-prop-1-en-2-ylcyclohexyl)oxyethanol (CID 122582289) is 2-(5,5-dimethyl-2-prop-1-en-2-ylcyclohexyl)oxyethanol.
What is the SMILES notation for 2-(5,5-dimethyl-2-prop-1-en-2-ylcyclohexyl)oxyethanol?
The canonical SMILES for 2-(5,5-dimethyl-2-prop-1-en-2-ylcyclohexyl)oxyethanol is C=C(C)C1CCC(C)(C)CC1OCCO.
What is the InChIKey of 2-(5,5-dimethyl-2-prop-1-en-2-ylcyclohexyl)oxyethanol?
The InChIKey is FJROGINBZQAAPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2/c1-10(2)11-5-6-13(3,4)9-12(11)15-8-7-14/h11-12,14H,1,5-9H2,2-4H3.
What are the key properties of 2-(5,5-dimethyl-2-prop-1-en-2-ylcyclohexyl)oxyethanol?
2-(5,5-dimethyl-2-prop-1-en-2-ylcyclohexyl)oxyethanol has a molecular weight of 212.33 g/mol, XLogP of 2.77, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,5-dimethyl-2-prop-1-en-2-ylcyclohexyl)oxyethanol is sourced from PubChem (CID 122582289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).