About ethyl 3-[(5,5-dimethyl-2-propan-2-ylcyclohexanecarbonyl)amino]butanoate
ethyl 3-[(5,5-dimethyl-2-propan-2-ylcyclohexanecarbonyl)amino]butanoate (PubChem CID 122582303) has the molecular formula C18H33NO3
and a molecular weight of 311.47 g/mol. Its IUPAC name is ethyl 3-[(5,5-dimethyl-2-propan-2-ylcyclohexanecarbonyl)amino]butanoate.
Molecular Properties
| Compound Name | ethyl 3-[(5,5-dimethyl-2-propan-2-ylcyclohexanecarbonyl)amino]butanoate |
| PubChem CID | 122582303 |
| Molecular Formula | C18H33NO3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.25 |
| IUPAC Name | ethyl 3-[(5,5-dimethyl-2-propan-2-ylcyclohexanecarbonyl)amino]butanoate |
| SMILES | CCOC(=O)CC(C)NC(=O)C1CC(C)(C)CCC1C(C)C |
| InChI | InChI=1S/C18H33NO3/c1-7-22-16(20)10-13(4)19-17(21)15-11-18(5,6)9-8-14(15)12(2)3/h12-15H,7-11H2,1-6H3,(H,19,21) |
| InChIKey | RHDIGIRCICKIKX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 3-[(5,5-dimethyl-2-propan-2-ylcyclohexanecarbonyl)amino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[(5,5-dimethyl-2-propan-2-ylcyclohexanecarbonyl)amino]butanoate?
The IUPAC name of ethyl 3-[(5,5-dimethyl-2-propan-2-ylcyclohexanecarbonyl)amino]butanoate (CID 122582303) is ethyl 3-[(5,5-dimethyl-2-propan-2-ylcyclohexanecarbonyl)amino]butanoate.
What is the SMILES notation for ethyl 3-[(5,5-dimethyl-2-propan-2-ylcyclohexanecarbonyl)amino]butanoate?
The canonical SMILES for ethyl 3-[(5,5-dimethyl-2-propan-2-ylcyclohexanecarbonyl)amino]butanoate is CCOC(=O)CC(C)NC(=O)C1CC(C)(C)CCC1C(C)C.
What is the InChIKey of ethyl 3-[(5,5-dimethyl-2-propan-2-ylcyclohexanecarbonyl)amino]butanoate?
The InChIKey is RHDIGIRCICKIKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33NO3/c1-7-22-16(20)10-13(4)19-17(21)15-11-18(5,6)9-8-14(15)12(2)3/h12-15H,7-11H2,1-6H3,(H,19,21).
What are the key properties of ethyl 3-[(5,5-dimethyl-2-propan-2-ylcyclohexanecarbonyl)amino]butanoate?
ethyl 3-[(5,5-dimethyl-2-propan-2-ylcyclohexanecarbonyl)amino]butanoate has a molecular weight of 311.47 g/mol, XLogP of 3.54, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(5,5-dimethyl-2-propan-2-ylcyclohexanecarbonyl)amino]butanoate is sourced from PubChem (CID 122582303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).