C14H25NO — CID 122582446
trans-(1S,2S)-N-ethyl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide (PubChem CID 122582446) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is trans-(1S,2S)-N-ethyl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide.
| Compound Name | trans-(1S,2S)-N-ethyl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 122582446 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | trans-(1S,2S)-N-ethyl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide |
| SMILES | C=C(C)[C@H]1CCC(C)(C)C[C@@H]1C(=O)NCC |
| InChI | InChI=1S/C14H25NO/c1-6-15-13(16)12-9-14(4,5)8-7-11(12)10(2)3/h11-12H,2,6-9H2,1,3-5H3,(H,15,16)/t11-,12+/m1/s1 |
| InChIKey | WPIGZHFYVTYTAC-NEPJUHHUSA-N |
| XLogP | 3.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|