About N-ethyl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide
N-ethyl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide (PubChem CID 122582448) has the molecular formula C14H25NO
and a molecular weight of 223.36 g/mol. Its IUPAC name is N-ethyl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide |
| PubChem CID | 122582448 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | N-ethyl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide |
| SMILES | C=C(C)C1CCC(C)(C)CC1C(=O)NCC |
| InChI | InChI=1S/C14H25NO/c1-6-15-13(16)12-9-14(4,5)8-7-11(12)10(2)3/h11-12H,2,6-9H2,1,3-5H3,(H,15,16) |
| InChIKey | WPIGZHFYVTYTAC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide?
The IUPAC name of N-ethyl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide (CID 122582448) is N-ethyl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide.
What is the SMILES notation for N-ethyl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide?
The canonical SMILES for N-ethyl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide is C=C(C)C1CCC(C)(C)CC1C(=O)NCC.
What is the InChIKey of N-ethyl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide?
The InChIKey is WPIGZHFYVTYTAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO/c1-6-15-13(16)12-9-14(4,5)8-7-11(12)10(2)3/h11-12H,2,6-9H2,1,3-5H3,(H,15,16).
What are the key properties of N-ethyl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide?
N-ethyl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide has a molecular weight of 223.36 g/mol, XLogP of 3.14, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide is sourced from PubChem (CID 122582448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).