About N-butan-2-yl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide
N-butan-2-yl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide (PubChem CID 122582450) has the molecular formula C16H29NO
and a molecular weight of 251.41 g/mol. Its IUPAC name is N-butan-2-yl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | N-butan-2-yl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide |
| PubChem CID | 122582450 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | N-butan-2-yl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide |
| SMILES | C=C(C)C1CCC(C)(C)CC1C(=O)NC(C)CC |
| InChI | InChI=1S/C16H29NO/c1-7-12(4)17-15(18)14-10-16(5,6)9-8-13(14)11(2)3/h12-14H,2,7-10H2,1,3-6H3,(H,17,18) |
| InChIKey | CWTDPXLCIJTWKP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-butan-2-yl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide?
The IUPAC name of N-butan-2-yl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide (CID 122582450) is N-butan-2-yl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide.
What is the SMILES notation for N-butan-2-yl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide?
The canonical SMILES for N-butan-2-yl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide is C=C(C)C1CCC(C)(C)CC1C(=O)NC(C)CC.
What is the InChIKey of N-butan-2-yl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide?
The InChIKey is CWTDPXLCIJTWKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29NO/c1-7-12(4)17-15(18)14-10-16(5,6)9-8-13(14)11(2)3/h12-14H,2,7-10H2,1,3-6H3,(H,17,18).
What are the key properties of N-butan-2-yl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide?
N-butan-2-yl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide has a molecular weight of 251.41 g/mol, XLogP of 3.92, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-5,5-dimethyl-2-prop-1-en-2-ylcyclohexane-1-carboxamide is sourced from PubChem (CID 122582450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).