C22H22N4O4 — CID 122582880
3,6-bis(oxiran-2-ylmethyl)-3a,6a-diphenyl-1,4-dihydroimidazo[4,5-d]imidazole-2,5-dione (PubChem CID 122582880) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is 3,6-bis(oxiran-2-ylmethyl)-3a,6a-diphenyl-1,4-dihydroimidazo[4,5-d]imidazole-2,5-dione.
| Compound Name | 3,6-bis(oxiran-2-ylmethyl)-3a,6a-diphenyl-1,4-dihydroimidazo[4,5-d]imidazole-2,5-dione |
|---|---|
| PubChem CID | 122582880 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 3,6-bis(oxiran-2-ylmethyl)-3a,6a-diphenyl-1,4-dihydroimidazo[4,5-d]imidazole-2,5-dione |
| SMILES | O=C1NC2(c3ccccc3)N(CC3CO3)C(=O)NC2(c2ccccc2)N1CC1CO1 |
| InChI | InChI=1S/C22H22N4O4/c27-19-23-21(15-7-3-1-4-8-15)22(16-9-5-2-6-10-16,26(19)12-18-14-30-18)24-20(28)25(21)11-17-13-29-17/h1-10,17-18H,11-14H2,(H,23,27)(H,24,28) |
| InChIKey | BRTWZOQOQPGUFM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 89.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|